|
HS 코드 |
795028 |
| Chemical Name | 2,2,3,3-Tetrafluoropropyl Methacrylate |
| Cas Number | 35115-98-5 |
| Molecular Formula | C7H8F4O2 |
| Molecular Weight | 200.13 g/mol |
| Appearance | Colorless liquid |
| Boiling Point | 105-108°C (at 760 mmHg) |
| Density | 1.232 g/cm3 at 25°C |
| Refractive Index | 1.382 at 20°C |
| Flash Point | 71°C |
| Purity | Typically ≥98% |
| Solubility | Insoluble in water, soluble in organic solvents |
| Storage Temperature | 2-8°C |
| Smiles | CC(=C)C(=O)OCC(C(F)F)C(F)F |
공인된 2,2,3,3-테트라플루오로프로필 메타크릴레이트 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 250 - gram bottle packaging for 2,2,3,3 - Tetrafluoropropyl Methacrylate. |
| Storage | 2,2,3,3 - Tetrafluoropropyl Methacrylate should be stored in a cool, dry, well - ventilated area away from heat, sparks, and open flames. Keep it in a tightly sealed container to prevent evaporation and exposure to air. Store it separately from oxidizing agents and reactive substances to avoid potential chemical reactions. |
| Shipping | 2,2,3,3 - Tetrafluoropropyl Methacrylate is shipped in well - sealed containers, following strict hazardous material regulations. Shipment is carefully monitored to ensure stability during transit, avoiding exposure to heat or incompatible substances. |
귀하의 예산에 맞는 경쟁력 있는 2,2,3,3-테트라플루오로프로필 메타크릴레이트 가격 - 모든 주문에 대해 유연한 조건과 맞춤형 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
