|
HS 코드 |
410919 |
| Name | 2-Phenylhydracrylic Acid |
| Cas Number | 614-70-0 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Appearance | White to light yellow crystalline powder |
| Melting Point | 106-109°C |
| Boiling Point | 332.8°C at 760 mmHg |
| Density | 1.213 g/cm3 |
| Solubility In Water | Slightly soluble |
| Purity | Typically ≥98% |
| Smiles | C1=CC=CC=C1C(C(=O)O)=C |
| Inchi | InChI=1S/C9H8O2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-6H,1H2,(H,10,11) |
공인된 2-페닐하이드아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100 - gram bottle of 2 - Phenylhydracrylic Acid, securely packaged for safe transit. |
| Storage | 2 - Phenylhydracrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to avoid dangerous reactions. |
| Shipping | 2 - Phenylhydracrylic Acid is shipped in accordance with chemical transport regulations. Packed securely in suitable containers, it's transported by methods ensuring stability, avoiding exposure to incompatible substances, and meeting safety standards during transit. |
귀하의 예산에 맞는 경쟁력 있는 2-페닐하이드아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
