|
HS 코드 |
760878 |
| Cas Number | 1443-98-7 |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.19 |
| Iupac Name | 2-thiophen-2-ylprop-2-enoic acid |
| Appearance | White to beige powder |
| Melting Point | 143-146°C |
| Solubility | Slightly soluble in water |
| Density | 1.34 g/cm3 (estimated) |
| Smiles | C=CC(=O)O c1cccs1 |
| Inchi | InChI=1S/C7H6O2S/c8-7(9)4-5-6-2-1-3-10-6/h1-5H,(H,8,9) |
| Synonyms | 2-Thienylacrylic acid; (E)-3-(2-Thienyl)acrylic acid |
공인된 2-티에닐아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 2 - Thienylacrylic Acid packaged in 1 - kg bags for secure storage and transport. |
| Storage | 2 - Thienylacrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to avoid chemical reactions. |
| Shipping | 2 - Thienylacrylic acid is shipped in well - sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipment follows strict chemical transport regulations to ensure safety during transit. |
귀하의 예산에 맞는 경쟁력 있는 2-티에닐아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
