|
HS 코드 |
951926 |
| Iupac Name | (2E)-3-(3-Bromophenyl)acrylic acid |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Cas Number | 55353-74-7 |
| Pubchem Cid | 3730911 |
| Appearance | White to light yellow solid |
| Melting Point | 172-174 °C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CC(=C1)Br)/C=C/C(=O)O |
| Inchi | InChI=1S/C9H7BrO2/c10-8-4-1-3-7(5-8)2-6-9(11)12/h1-6H,(H,11,12)/b6-2+ |
| Synonyms | m-Bromocinnamic acid |
| Storage Conditions | Store at 2-8°C, protected from light |
공인된 (2E)-3-(3-브로모페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of (2E)-3-(3 - Bromophenyl)Acrylic Acid in a sealed chemical - grade bag. |
| Storage | (2E)-3-(3 - Bromophenyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to ensure safety. |
| Shipping | (2E)-3-(3-Bromophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It's transported under regulated conditions, ensuring compliance with chemical safety regulations to prevent any damage or leakage during transit. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(3-브로모페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
