|
HS 코드 |
808263 |
| Iupac Name | (2E)-3-(3-Fluorophenyl)acrylic acid |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 g/mol |
| Cas Number | 552308-36-4 |
| Appearance | White to off-white solid |
| Melting Point | 153-157 °C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CC(=C1)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H7FO2/c10-8-4-1-3-7(6-8)2-5-9(11)12/h1-6H,(H,11,12)/b5-2+ |
| Purity | Typically ≥98% |
| Storage Temperature | Store at 2-8°C |
| Synonyms | 3-(3-Fluorophenyl)acrylic acid |
공인된 (2E)-3-(3-플루오로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(3 - Fluorophenyl)Acrylic Acid in a sealed, chemical - resistant bag. |
| Storage | (2E)-3-(3-Fluorophenyl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contamination. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid potential chemical reactions. |
| Shipping | (2E)-3-(3-Fluorophenyl)acrylic acid is shipped with careful packaging to prevent breakage. It's handled in accordance with chemical transport regulations, ensuring safe transit to the destination. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(3-플루오로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
