|
HS 코드 |
699416 |
| Iupac Name | (2E)-3-(3-Methoxyphenyl)acrylic acid |
| Cas Number | 578-09-8 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| Appearance | White to off-white crystalline powder |
| Melting Point | 164-168°C |
| Solubility In Water | Slightly soluble |
| Smiles | COC1=CC=CC(=C1)C=CC(=O)O |
| Inchi | InChI=1S/C10H10O3/c1-13-9-5-2-3-8(6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ |
공인된 (2E)-3-(3-메톡시페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(3 - Methoxyphenyl)Acrylic Acid in a sealed, labeled chemical - grade container. |
| Storage | (2E)-3-(3 - Methoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and bases, as it can react with them. Ideal storage temperature is around 2 - 8°C for long - term stability. |
| Shipping | (2E)-3-(3 - Methoxyphenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safe transit to prevent any leakage or damage during shipping. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(3-메톡시페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
