|
HS 코드 |
248463 |
| Iupac Name | (2E)-3-(3-methylthiophen-2-yl)prop-2-enoic acid |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.21 g/mol |
| Cas Number | 50918-02-6 |
| Appearance | Solid (typically powder or crystalline) |
| Melting Point | Approximately 150-152 °C |
| Boiling Point | Decomposition before boiling |
| Solubility In Water | Poorly soluble |
| Smiles | CC1=CSC=C1C=CC(=O)O |
| Inchi | InChI=1S/C8H8O2S/c1-6-3-5-11-7(6)2-4-8(9)10/h2-5H,1H3,(H,9,10)/b4-2+ |
| Synonyms | 3-(3-Methyl-2-thienyl)acrylic acid |
| Purity | Typically ≥ 98% (depending on supplier) |
공인된 (2E)-3-(3-메틸-2-티에닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(3 - Methyl - 2 - Thienyl)Acrylic Acid in a sealed, labeled container. |
| Storage | (2E)-3-(3 - Methyl - 2 - thienyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store in a well - ventilated area, separate from incompatible substances like strong oxidizing agents. Avoid exposure to sunlight to maintain its chemical stability. |
| Shipping | (2E)-3-(3 - Methyl - 2 - thienyl)acrylic acid is shipped in sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipments follow regulations for chemical transportation to ensure safety. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(3-메틸-2-티에닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.