|
HS 코드 |
475587 |
| Iupac Name | (2E)-3-(4-Bromo-2-chlorophenyl)acrylic acid |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 |
| Cas Number | 141995-96-2 |
| Appearance | Off-white to light brown solid |
| Melting Point | 173-176°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Br)Cl |
| Inchi | InChI=1S/C9H6BrClO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Purity | Typically >98% |
| Storage Condition | Store at 2-8°C, protected from light |
공인된 (2E)-3-(4-브로모-2-클로로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid in sealed, labeled containers. |
| Storage | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, to ensure its chemical stability. |
| Shipping | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safety during transit to prevent spills and environmental exposure. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(4-브로모-2-클로로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
