|
HS 코드 |
746657 |
| Iupac Name | (2E)-3-(4-Bromo-2-fluorophenyl)acrylic acid |
| Molecular Formula | C9H6BrFO2 |
| Molecular Weight | 245.05 g/mol |
| Cas Number | 885278-96-6 |
| Appearance | White to off-white solid |
| Melting Point | 156-160°C |
| Solubility | Slightly soluble in water, soluble in organic solvents like DMSO and methanol |
| Smiles | C1=CC(=C(C=C1Br)C=CC(=O)O)F |
| Inchi | InChI=1S/C9H6BrFO2/c10-7-3-1-6(9(12)13)4-8(7)11-5-2-9/h1-5H,(H,12,13)/b6-1+ |
| Purity | Typically ≥ 98% |
| Storage Temperature | 2-8°C |
| Synonyms | 4-Bromo-2-fluoro-cinnamic acid |
공인된 (2E)-3-(4-브로모-2-플루오로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Fluorophenyl)Acrylic Acid in sealed chemical - grade bags. |
| Storage | (2E)-3-(4 - Bromo - 2 - fluorophenyl)acrylic acid should be stored in a cool, dry place away from heat sources and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. |
| Shipping | (2E)-3-(4 - Bromo - 2 - fluorophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. Shipment follows strict chemical transport regulations, ensuring safety during transit to prevent any leakage or damage. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(4-브로모-2-플루오로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.