|
HS 코드 |
446265 |
| Iupac Name | (2E)-3-(4-chloro-3-nitrophenyl)acrylic acid |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Cas Number | 32726-82-8 |
| Appearance | Yellow crystalline powder |
| Melting Point | 220-222°C |
| Solubility | Slightly soluble in water; soluble in organic solvents like DMSO and methanol |
| Smiles | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-7-3-1-6(9(12)13)2-8(7)11(14)15/h1-3H,(H,12,13)/b6-1+ |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C, protected from light and moisture |
| Pka | 4.2 (for the carboxylic acid group) |
| Hazard Statements | H315, H319, H335 |
공인된 (2E)-3-(4-클로로-3-니트로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid in airtight chemical - grade packaging. |
| Storage | (2E)-3-(4 - Chloro - 3 - nitrophenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air. Store it separately from incompatible substances like strong oxidizers and bases to avoid potential reactions. |
| Shipping | (2E)-3-(4 - Chloro - 3 - nitrophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It follows strict hazardous chemical shipping regulations to ensure safe transport due to its chemical nature. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(4-클로로-3-니트로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.