|
HS 코드 |
574163 |
| Iupac Name | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Cas Number | 1076196-53-8 |
| Appearance | White to off-white solid |
| Melting Point | 129-133°C |
| Solubility In Water | Slightly soluble |
| Smiles | COC1=CC(=C(C=C1)C=CC(=O)O)F |
| Inchi | InChI=1S/C10H9FO3/c1-14-9-5-7(2-3-10(12)13)4-8(11)6-9/h2-6H,1H3,(H,12,13)/b3-2+ |
| Storage Conditions | Store at 2-8°C, protect from light |
공인된 (2E)-3-(4-플루오로-3-메톡시페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(4 - Fluoro - 3 - Methoxyphenyl)Acrylic Acid in sealed plastic bags. |
| Storage | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances to avoid potential chemical reactions. |
| Shipping | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid is shipped in sealed, corrosion - resistant containers. Strict compliance with chemical transportation regulations ensures safe transit, protecting both handlers and the environment. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(4-플루오로-3-메톡시페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.