|
HS 코드 |
317786 |
| Iupac Name | (2E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 119224-15-6 |
| Appearance | Solid (exact color may vary, typically off-white to light yellow) |
| Solubility | Slightly soluble in water, more soluble in organic solvents |
| Boiling Point | Decomposes before boiling |
| Smiles | C1CC(=CC(C1)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-6-7-3-1-2-4-8(7)10(13)14/h5-6H,1-4H2,(H,11,12)/b6-5+ |
| Pubchem Cid | 20071461 |
| Storage Conditions | Store in a cool, dry place, away from light and incompatible substances |
| Functional Groups | Nitro, carboxylic acid, alkene, cyclohexene |
공인된 (2E)-3-(5-니트로시클로헥스-1-에닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | Packaging: 1 kg of (2E)-3-(5 - Nitrocyclohex - 1 - enyl)acrylic acid in airtight container. |
| Storage | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to chemical degradation. Store it separately from incompatible substances like strong oxidizers and bases to ensure safety. |
| Shipping | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid is shipped in properly sealed, corrosion - resistant containers. Shipment adheres to strict chemical transport regulations, ensuring safety during transit. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(5-니트로시클로헥스-1-에닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
