|
HS 코드 |
183118 |
| Iupac Name | (2E)-3-Ethoxyacrylic acid |
| Cas Number | 53521-53-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 92-94 °C at 20 mmHg |
| Density | 1.096 g/cm³ (approximate) |
| Solubility In Water | Moderately soluble |
| Smiles | CCOC=CC(=O)O |
| Inchi | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3+ |
| Refractive Index | 1.440 (approximate) |
| Ec Number | 258-396-3 |
공인된 (2E)-3-에톡시아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3 - Ethoxyacrylic Acid in a sealed, corrosion - resistant plastic bottle. |
| Storage | (2E)-3 - Ethoxyacrylic acid should be stored in a cool, dry, well - ventilated area, away from heat sources and ignition points. Keep it in a tightly sealed container to prevent contact with air and moisture, which could potentially cause degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3 - Ethoxyacrylic Acid is shipped in carefully sealed, corrosion - resistant containers. Shipment adheres to strict chemical transportation regulations, ensuring safe transit to prevent spills and maintain product integrity. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-에톡시아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
