|
HS 코드 |
838432 |
| Iupac Name | (2E)-3-(pyridin-3-yl)acrylic acid |
| Cas Number | 51762-05-9 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 165-167°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CN=C1)/C=C/C(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-5-7-2-1-3-9-6-7/h1-6H,(H,10,11)/b5-4+ |
| Pubchem Cid | 166713 |
| Pka | 4.43 (carboxylic acid group) |
| Synonyms | β-(3-Pyridyl)acrylic acid; 3-Pyridylacrylic acid |
| Logp | 0.97 |
공인된 (2E)-3-(피리딘-3-일)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (2E)-3-(Pyridin-3-yl)acrylic acid in sealed, chemical - resistant bags. |
| Storage | (2E)-3-(Pyridin - 3 - yl)acrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3-(Pyridin-3-yl)acrylic acid is shipped in well - sealed containers, compliant with chemical transport regulations. Special care is taken to prevent damage, with proper cushioning and secure packaging for safe transit. |
귀하의 예산에 맞는 경쟁력 있는 (2E)-3-(피리딘-3-일)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
