|
HS 코드 |
104158 |
| Product Name | 3-(1-Naphthyl)Acrylic Acid |
| Chemical Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Cas Number | 137-52-0 |
| Appearance | White to off-white solid |
| Melting Point | 157-161°C |
| Solubility | Slightly soluble in water; soluble in organic solvents |
| Storage Temperature | Room temperature |
| Purity | Typically ≥98% |
| Smiles | C1=CC=C2C(=C1)C=CC=C2C=CC(=O)O |
| Iupac Name | 3-(naphthalen-1-yl)prop-2-enoic acid |
| Synonyms | β-(1-Naphthyl)acrylic acid; trans-3-(1-Naphthyl)acrylic acid |
공인된 3-(1-나프틸)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of 3-(1 - Naphthyl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(1 - Naphthyl)Acrylic Acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizing agents, to avoid chemical reactions. |
| Shipping | 3-(1 - Naphthyl)Acrylic Acid is shipped in well - sealed containers, compliant with chemical transportation regulations. Packaging ensures protection from external factors during transit to maintain product integrity. |
귀하의 예산에 맞는 경쟁력 있는 3-(1-나프틸)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.