|
HS 코드 |
516880 |
| Productname | 3-(3,5-Difluorophenyl)Acrylic Acid |
| Casnumber | 886762-63-0 |
| Molecularformula | C9H6F2O2 |
| Molecularweight | 184.14 |
| Appearance | White to off-white solid |
| Meltingpoint | 119-121°C |
| Purity | Typically >98% |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Smiles | C1=C(C=C(C=C1F)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H6F2O2/c10-7-4-6(5-8(11)3-7)2-1-9(12)13/h1-5H,(H,12,13) |
| Storagetemperature | 2-8°C |
| Synonyms | 3-(3,5-Difluorophenyl)propenoic acid |
공인된 3-(3,5-디플루오로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3-(3,5 - Difluorophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(3,5 - Difluorophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent contact with air and moisture, which could potentially degrade the chemical. Store it separately from incompatible substances to avoid any chemical reactions. |
| Shipping | 3-(3,5 - Difluorophenyl)Acrylic Acid is shipped in properly sealed, corrosion - resistant containers. Packaging adheres to chemical transport regulations to ensure safe transit, protecting from physical damage and environmental exposure. |
귀하의 예산에 맞는 경쟁력 있는 3-(3,5-디플루오로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.