|
HS 코드 |
282500 |
| Productname | 3-(3-Furyl)Acrylic Acid |
| Casnumber | 614-59-5 |
| Molecularformula | C7H6O3 |
| Molecularweight | 138.12 g/mol |
| Appearance | White to beige crystalline powder |
| Meltingpoint | 189-193°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Density | 1.35 g/cm³ (approximate) |
| Purity | Typically ≥98% |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)4-5-6-1-2-10-3-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storageconditions | Store at 2-8°C, protect from light and moisture |
| Pka | Approx. 4.3 |
공인된 3-(3-푸릴)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3-(3 - Furyl)Acrylic Acid in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Furyl)Acrylic Acid should be stored in a cool, dry place, away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizing agents. Ideal storage temperature is around 2 - 8 °C if long - term stability is required. |
| Shipping | 3-(3 - Furyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipments comply with all chemical transport regulations to ensure safe delivery. |
귀하의 예산에 맞는 경쟁력 있는 3-(3-푸릴)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
