|
HS 코드 |
167281 |
| Chemical Name | 3-(3-Pyridyl)acrylic acid |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Cas Number | 7406-77-9 |
| Appearance | White to off-white solid |
| Melting Point | 149-153°C |
| Solubility | Soluble in water and organic solvents |
| Smiles | C1=CC(=CN=C1)C=CC(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11) |
| Synonyms | beta-(3-Pyridyl)acrylic acid |
| Purity | Typically ≥98% |
| Storage Conditions | Store at room temperature in a dry place |
공인된 3-(3-피리딜)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of 3-(3 - Pyridyl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Pyridyl)Acrylic Acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to ensure its stability and integrity over time. |
| Shipping | 3-(3 - Pyridyl)Acrylic Acid is shipped in well - sealed containers, safeguarded against physical damage. Transport follows strict chemical safety regulations, ensuring secure delivery to prevent any leakage or hazards during transit. |
귀하의 예산에 맞는 경쟁력 있는 3-(3-피리딜)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
