|
HS 코드 |
282099 |
| Chemical Name | 3-[4-(Benzyloxy)Phenyl]Acrylic Acid |
| Cas Number | 13013-70-4 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| Appearance | White to off-white solid |
| Melting Point | 166-170°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Purity | Typically ≥98% |
| Smiles | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=CC(=O)O |
| Inchi | InChI=1S/C16H14O3/c17-16(18)9-10-14-6-8-15(9)19-12-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,17,18) |
| Storage Conditions | Keep in a cool, dry place, protected from light |
| Synonyms | 4-(Benzyloxy)cinnamic acid |
공인된 3-[4-(벤질옥시)페닐]아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 표준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of 3 - [4-(Benzyloxy)phenyl]Acrylic Acid in sealed, chemical - resistant packaging. |
| Storage | 3 - [4 - (Benzyloxy)phenyl]acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances to avoid chemical reactions. Ensure the storage area has good ventilation. |
| Shipping | 3-[4-(Benzyloxy)phenyl]Acrylic Acid is shipped in accordance with chemical safety regulations. Packed in suitable containers to prevent spillage, it's transported by approved carriers, ensuring proper handling during transit. |
귀하의 예산에 맞는 경쟁력 있는 3-[4-(벤질옥시)페닐]아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
