|
HS 코드 |
875699 |
| Productname | 3-(4-Chloro-3-Nitrophenyl)Acrylic Acid |
| Casnumber | 32727-66-3 |
| Molecularformula | C9H6ClNO4 |
| Molecularweight | 227.6 g/mol |
| Appearance | Yellow solid |
| Meltingpoint | 181-185 °C |
| Solubility | Slightly soluble in water |
| Purity | Typically ≥98% |
| Smiles | C1=CC(=C(C=C1Cl)N(=O)=O)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-8-4-6(1-2-9(12)13)3-7(5-8)11(14)15/h1-5H,(H,12,13) |
| Storagetemperature | 2-8 °C |
| Synonyms | 4-Chloro-3-nitrocinnamic acid |
공인된 3-(4-클로로-3-니트로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing or reducing agents, to avoid chemical reactions. |
| Shipping | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Special handling precautions are taken due to its chemical nature, following strict regulations to ensure safe transportation. |
귀하의 예산에 맞는 경쟁력 있는 3-(4-클로로-3-니트로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
