|
HS 코드 |
727609 |
| Iupac Name | 3-(4-Hydroxy-3-methoxyphenyl)acrylic acid |
| Common Name | Ferulic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18 g/mol |
| Cas Number | 1135-24-6 |
| Appearance | Off-white to yellow crystalline powder |
| Melting Point | 172-174°C |
| Solubility In Water | Slightly soluble |
| Pka | 4.58 |
| Smiles | COC1=CC=C(C=C1O)C=CC(=O)O |
| Inchi | InChI=1S/C10H10O4/c1-14-9-5-7(2-3-10(12)13)4-8(11)6-9/h2-6,11H,1H3,(H,12,13) |
| Density | 1.34 g/cm³ |
| Logp | 1.5 |
| Refractive Index | 1.579 |
공인된 3-(4-하이드록시-3-메톡시페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could lead to degradation. Store it separately from incompatible substances to avoid potential chemical reactions. |
| Shipping | 3-(4 - Hydroxy - 3 - Methoxyphenyl)Acrylic Acid is shipped in properly sealed containers, following strict chemical transport regulations. Packaging ensures protection from damage and leakage during transit. |
귀하의 예산에 맞는 경쟁력 있는 3-(4-하이드록시-3-메톡시페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.