|
HS 코드 |
787814 |
| Product Name | 3-(4-Nitrophenyl)Acrylic Acid |
| Cas Number | 104-91-6 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Appearance | Yellow to orange powder |
| Melting Point | 202-204 °C |
| Solubility | Slightly soluble in water; soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Iupac Name | (E)-3-(4-nitrophenyl)prop-2-enoic acid |
| Synonyms | p-Nitrocinnamic acid |
| Smiles | C1=CC(=CC=C1C=CC(=O)O)[N+](=O)[O-] |
| Inchikey | FBUBBHPXCVIZCF-UHFFFAOYSA-N |
| Storage Conditions | Store at room temperature, protected from moisture and light |
공인된 3-(4-니트로페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3-(4 - Nitrophenyl)Acrylic Acid packaged in a sealed, chemical - resistant container. |
| Storage | 3-(4 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air. Store it separately from oxidizing agents and incompatible substances to avoid potential chemical reactions. Suitable storage temperature is typically around 2 - 8°C if possible for long - term stability. |
| Shipping | 3-(4 - Nitrophenyl)Acrylic Acid is shipped in accordance with chemical regulations. Packed securely in suitable containers, it's transported by carriers trained in handling hazardous chemicals to ensure safe and proper delivery. |
귀하의 예산에 맞는 경쟁력 있는 3-(4-니트로페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
