|
HS 코드 |
514083 |
| Chemical Name | 3-Furanylacrylic Acid |
| Cas Number | 609-97-8 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 148-150 °C |
| Solubility | Slightly soluble in water |
| Density | 1.371 g/cm3 |
| Pubchem Cid | 12611 |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)3-6-2-1-5-10-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storage Conditions | Store at room temperature, tightly closed |
공인된 3-푸라닐아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of 3 - Furanylacrylic Acid packaged in a sealed, air - tight plastic bag. |
| Storage | 3 - Furanylacrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. Ideal storage temperature is around room temperature, avoiding extreme hot or cold conditions. |
| Shipping | 3 - Furanylacrylic Acid is shipped in sealed, corrosion - resistant containers. Packaging ensures protection from moisture and physical damage. Shipments follow strict chemical transportation regulations for safe delivery. |
귀하의 예산에 맞는 경쟁력 있는 3-푸라닐아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤형 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
