|
HS 코드 |
555529 |
| Product Name | 3-Methoxyacrylic Acid Methyl Ester |
| Cas Number | 2706-99-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 128-130°C (at 760 mmHg) |
| Density | 1.065 g/cm3 (at 25°C) |
| Refractive Index | 1.422 (at 20°C) |
| Flash Point | 44°C |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents like ethanol and ether |
| Smiles | COC(=C)C(=O)OC |
| Inchi | InChI=1S/C5H8O3/c1-7-4-3-5(6)8-2/h3-4H,1-2H3 |
공인된 3-메톡시아크릴산 메틸 에스테르 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500 - gram bottles with tight - sealed caps for 3 - Methoxyacrylic Acid Methyl Ester. |
| Storage | 3 - Methoxyacrylic Acid Methyl Ester should be stored in a cool, dry, well - ventilated area, away from direct sunlight. Keep it in a tightly sealed container to prevent evaporation and contact with air. Store it separately from oxidizing agents and incompatible substances. Ensure storage temperature is maintained within a suitable range, typically around room temperature, to prevent decomposition. |
| Shipping | 3 - Methoxyacrylic Acid Methyl Ester is shipped in accordance with strict chemical transport regulations. It's typically packaged in sealed, corrosion - resistant containers. Shipments are carefully monitored for temperature and handling to ensure safety during transit. |
귀하의 예산에 맞는 경쟁력 있는 3-메톡시아크릴산 메틸 에스테르 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
