|
HS 코드 |
936910 |
| Product Name | 3B-Indole Acrylic Acid |
| Cas Number | 830-96-6 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Appearance | White to off-white powder |
| Melting Point | 153-156°C |
| Solubility | Slightly soluble in water, soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Pka | 4.6 (carboxyl group) |
| Smiles | C1=CC=C2C(=C1)C=CN2C=CC(=O)O |
| Application | Intermediate in organic synthesis and research |
공인된 3B-인돌 아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100 - gram pack of 3 - Indole Acrylic Acid in air - tight, chemical - resistant packaging. |
| Storage | 3 - Indole Acrylic Acid should be stored in a cool, dry place, away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances. This helps maintain its chemical integrity and reduces the risk of degradation or dangerous reactions. |
| Shipping | 3 - Indole Acrylic Acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills and damage, often in sealed containers. Shipment may involve temperature - controlled environments if required for stability. |
귀하의 예산에 맞는 경쟁력 있는 3B-인돌 아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
