|
HS 코드 |
582074 |
| Productname | Acrylic Acid 2,2,3,3,4,4,5,5-Octafluoropentyl Ester~1H,1H,5H-Perfluoro-1-Pentyl Acrylate |
| Casnumber | 87048-35-5 |
| Molecularformula | C8H6F8O2 |
| Molecularweight | 282.12 |
| Appearance | Colorless liquid |
| Boilingpoint | 108-110°C at 13 mmHg |
| Density | 1.43 g/cm3 |
| Refractiveindex | n20/D 1.355 |
| Flashpoint | >110°C |
| Solubility | Insoluble in water |
| Purity | Typically ≥98% |
| Storagetemperature | 2-8°C |
| Smiles | C=CC(=O)OCCCC(C(F)(F)C(F)(F)F)F |
| Inchikey | QIWJQNGQQOIATQ-UHFFFAOYSA-N |
인증된 아크릴산 2,2,3,3,4,4,5,5-옥타플루오로펜틸 에스터~1H,1H,5H-퍼플루오로-1-펜틸 아크릴레이트 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester in sealed, labeled container. |
| Storage | Store "Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester~1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate" in a cool, well - ventilated area away from heat, sparks, and open flames. Keep it in a tightly - sealed container to prevent vapor release. Store separately from oxidizing agents and incompatible substances to avoid potential reactions. |
| Shipping | Acrylic Acid 2,2,3,3,4,4,5,5 - Octafluoropentyl Ester ~ 1H,1H,5H - Perfluoro - 1 - Pentyl Acrylate is shipped in specialized containers, ensuring proper containment and safety, compliant with chemical transportation regulations. |
귀하의 예산에 맞는 경쟁력 있는 아크릴산 2,2,3,3,4,4,5,5-옥타플루오로펜틸 에스터~1H,1H,5H-퍼플루오로-1-펜틸 아크릴레이트 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.