|
HS 코드 |
230815 |
| Productname | Acrylic Acid 6-(4-Hydroxy-Phenoxy)-Hexyl Ester |
| Molecularformula | C15H20O4 |
| Molecularweight | 264.32 g/mol |
| Casnumber | 153167-82-5 |
| Appearance | Colorless to light yellow liquid |
| Purity | ≥98% |
| Density | Approx. 1.15 g/cm³ |
| Solubility | Soluble in organic solvents |
| Functionalgroups | Acrylic ester, phenol |
| Storagetemperature | 2-8°C |
| Refractiveindex | Approx. 1.523 |
| Flashpoint | >110°C |
| Smiles | C=CC(=O)OCCCCCCOc1ccc(O)cc1 |
인증된 아크릴산 6-(4-하이드록시-페녹시)-헥실 에스테르 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of Acrylic Acid 6-(4-Hydroxy - Phenoxy) - Hexyl Ester in air - tight, labeled containers. |
| Storage | "Acrylic Acid 6-(4-Hydroxy-Phenoxy) -Hexyl Ester" should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and oxidation. Store separately from incompatible substances like strong oxidizers, bases, and amines to avoid potential chemical reactions. |
| Shipping | Acrylic Acid 6-(4-Hydroxy-Phenoxy) -Hexyl Ester is shipped in containers suitable for chemicals. Packaging ensures protection from external factors. Shipment follows strict safety regulations for handling and transporting this chemical. |
귀하의 예산에 맞는 경쟁력 있는 아크릴산 6-(4-하이드록시-페녹시)-헥실 에스테르 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
