|
HS 코드 |
851006 |
| Product Name | Alpha-Trifluoromethylacrylic Acid-Tert-Butylester |
| Cas Number | 142595-44-0 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 |
| Appearance | Colorless to pale yellow liquid |
| Density | 1.159 g/cm3 |
| Purity | Typically ≥97% |
| Smiles | CC(C)(C)OC(=O)C(=C)C(F)(F)F |
| Refractive Index | n20/D 1.388 |
| Storage Temperature | 2-8°C |
| Solubility | Insoluble in water |
| Synonyms | tert-Butyl α,α,α-trifluoroacrylate |
공인된 알파-트리플루오로메틸아크릴산-테르트-부틸에스테르 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 1L bottle of Alpha - Trifluoromethylacrylic Acid - Tert - Butylester, well - sealed for chemical storage. |
| Storage | Alpha - Trifluoromethylacrylic Acid - Tert - Butylester should be stored in a cool, dry, well - ventilated area, away from heat sources and open flames. Keep it in a tightly - sealed container to prevent evaporation and exposure to air or moisture, which could potentially lead to decomposition or unwanted reactions. Store it separately from oxidizing agents and incompatible substances. |
| Shipping | Alpha - Trifluoromethylacrylic Acid - Tert - Butylester is shipped in specialized containers designed to prevent leakage. It's transported under regulated conditions, ensuring compliance with chemical safety standards during transit. |
귀하의 예산에 맞는 경쟁력 있는 알파-트리플루오로메틸아크릴산-Tert-부틸에스테르 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
