|
HS 코드 |
665624 |
| Cas Number | 614-19-7 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Iupac Name | 2-Phenylacrylic acid |
| Synonyms | Atropic acid, alpha-Phenylacrylic acid |
| Appearance | White to off-white crystalline powder |
| Melting Point | 104-106°C |
| Boiling Point | 277°C |
| Solubility In Water | Slightly soluble |
| Density | 1.155 g/cm³ |
| Smiles | C1=CC=C(C=C1)C=CC(=O)O |
| Inchi | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11) |
공인된 아트로프산/2-페닐아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 1 kg of Atropic Acid/2 - Phenylacrylic Acid in sealed, chemical - resistant packaging. |
| Storage | Atropic acid/2 - Phenylacrylic acid should be stored in a cool, dry, well - ventilated area. Keep it away from heat, flames, and oxidizing agents. Store in a tightly - sealed container to prevent moisture absorption and degradation. It's advisable to store it separately from incompatible substances to avoid potential chemical reactions. |
| Shipping | Atropic Acid/2 - Phenylacrylic Acid is shipped in sealed, corrosion - resistant containers. These are carefully packaged to prevent leakage during transit, following strict chemical transportation safety regulations. |
귀하의 예산에 맞는 경쟁력 있는 아트로프산/2-페닐아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.