|
HS 코드 |
191865 |
| Product Name | (E)-3-(3,5-Dimethoxyphenyl)Acrylic Acid |
| Cas Number | 82639-36-9 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| Appearance | White to off-white solid |
| Melting Point | 145-149°C |
| Solubility | Slightly soluble in water, soluble in organic solvents such as ethanol and DMSO |
| Purity | Typically >98% |
| Smiles | COc1cc(cc(OC)c1)C=CC(=O)O |
| Inchi | InChI=1S/C11H12O4/c1-14-9-6-8(5-7-10(12)13)4-11(15-2)3-9/h4-7H,1-3H3,(H,12,13)/b7-5+ |
| Storage Temperature | 2-8°C (refrigerated) |
| Synonyms | trans-3-(3,5-Dimethoxyphenyl)acrylic acid |
공인된 (E)-3-(3,5-디메톡시페닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 500g of (E)-3-(3,5 - Dimethoxyphenyl)Acrylic Acid in sealed, labeled chemical - grade bags. |
| Storage | (E)-3-(3,5 - Dimethoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances to avoid chemical reactions. |
| Shipping | ( E ) -3-(3,5 -Dimethoxyphenyl)Acrylic Acid is shipped in properly sealed, corrosion - resistant containers. Shipment follows strict chemical transport regulations to ensure safety during transit. |
귀하의 예산에 맞는 경쟁력 있는 (E)-3-(3,5-디메톡시페닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.