|
HS 코드 |
812862 |
| Iupac Name | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 1219801-51-6 |
| Appearance | Yellow to orange solid |
| Melting Point | Approx. 132-134°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1CC(CC=C1[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h4-5,7H,1-3,6H2,(H,11,12)/b5-4+ |
| Logp | 1.7 |
| Boiling Point | Decomposes before boiling |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, protected from light |
| Synonyms | trans-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
공인된 (E)-3-(5-니트로시클로헥스-1-엔-1-일)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of (E)-3-(5 - Nitrocyclohex - 1 - en - 1 - yl)acrylic acid in sealed chemical - grade bag. |
| Storage | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid chemical reactions. |
| Shipping | (E)-3-(5 - Nitrocyclohex-1-en-1-yl)acrylic acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills, in containers suitable for its chemical nature, and transported by approved carriers. |
귀하의 예산에 맞는 경쟁력 있는 (E)-3-(5-니트로시클로헥스-1-엔-1-일)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤형 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
