|
HS 코드 |
639598 |
| Iupac Name | (E)-6-[(E)-3-(1-Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.41 g/mol |
| Appearance | Solid (exact color varies; generally white to off-white) |
| Solubility | Slightly soluble in water; soluble in common organic solvents (e.g., DMSO, ethanol) |
| Smiles | Cc1ccc(/C=C/C(N2CCCC2)=C/C=C/c3cccc(C(=O)O)n3)cc1 |
| Inchi | InChI=1S/C21H22N2O2/c1-16-7-9-18(10-8-16)6-5-19(23-13-2-3-14-23)12-4-17-11-15-20(21(24)25)22-17/h4-12,15H,2-3,13-14H2,1H3,(H,24,25)/b6-5+,19-12+ |
| Logp | Estimated 4.2 |
| Pka | Estimated 4.5 (carboxylic acid group) |
| Storage Conditions | Store in a cool, dry place; protect from light and moisture |
| Synonyms | No widely used synonyms; refer to systematic name |
| Chemical Class | Acrylic acid derivative |
공인된 (E)-6-[(E)-3-(1-피롤리디닐)-1-P-톨릴프로페닐]-2-피리딘아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of (E)-6-[(E)-3-(1 - Pyrrolidinyl)-1-p-tolylpropenyl]-2 - Pyridineacrylic Acid in sealed vial. |
| Storage | Store (E)-6-[(E)-3-(1 -Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid in a cool, dry place, away from direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contamination. Avoid storing near reactive substances. The ideal storage temperature is typically around 2 - 8 °C if refrigeration is specified for long - term stability. |
| Shipping | The chemical (E)-6-[(E)-3-(1 -Pyrrolidinyl)-1-p-tolylpropenyl]-2-pyridineacrylic acid is shipped in containers suitable for chemicals. Packaging ensures protection from external factors during transit to maintain its integrity. |
귀하의 예산에 맞는 경쟁력 있는 (E)-6-[(E)-3-(1-피롤리디닐)-1-P-톨릴프로페닐]-2-피리딘아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.