|
HS 코드 |
641153 |
| Cas Number | 2370-63-0 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Appearance | Clear colorless liquid |
| Boiling Point | 252 °C |
| Density | 1.063 g/mL at 25°C |
| Flash Point | 114 °C |
| Refractive Index | 1.436 at 20 °C |
| Solubility | Soluble in organic solvents, slightly soluble in water |
| Purity | Typically ≥98% |
| Structural Formula | CH2=C(CH3)COOCH2CH2OCH2CH2OCH3 |
공인된 메톡시에톡시에틸 메타크릴레이트 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 5 - liter canister packaging for Methoxyethoxyethyl Methacrylate chemical. |
| Storage | Methoxyethoxyethyl Methacrylate should be stored in a cool, well - ventilated area, away from heat, sparks, and open flames. Keep containers tightly closed to prevent vapor release. Store it separately from oxidizing agents and reactive substances. The storage area should be dry, as moisture can initiate unwanted reactions. Use proper labeling to ensure easy identification and safety. |
| Shipping | Methoxyethoxyethyl Methacrylate is shipped in accordance with strict chemical transport regulations. It's typically in sealed, corrosion - resistant containers to prevent leakage during transit, ensuring safety in handling and transportation. |
귀하의 예산에 맞는 경쟁력 있는 메톡시에톡시에틸 메타크릴레이트 가격 - 모든 주문에 대해 유연한 조건과 맞춤형 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
