|
HS 코드 |
377670 |
| Cas Number | 109-17-1 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 390.43 g/mol |
| Appearance | Clear, colorless to pale yellow liquid |
| Odor | Mild ester-like odor |
| Boiling Point | Approx. 220°C (428°F) |
| Density | 1.089 g/cm³ at 25°C |
| Viscosity | 110-135 mPa·s at 25°C |
| Flash Point | 140°C (284°F) |
| Solubility | Insoluble in water; soluble in organic solvents |
| Refractive Index | 1.461 at 20°C |
| Melting Point | -38°C |
| Purity | Typically ≥ 98% |
| Chemical Structure | CH2=C(CH3)COO(CH2CH2O)4COC(CH3)=CH2 |
| Stability | Stable under recommended storage conditions |
공인된 테트라에틸렌글리콜디메타크릴레이트 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | Tetraethylene Glycol Dimethacrylate in 5 - liter containers, securely packaged. |
| Storage | Tetraethylene Glycol Dimethacrylate should be stored in a cool, dry, well - ventilated area. Keep it away from heat sources, flames, and oxidizing agents. Store in a tightly - sealed container to prevent evaporation and contact with air. Since it is a flammable and reactive chemical, ensure storage conditions minimize the risk of ignition and unwanted reactions. |
| Shipping | Tetraethylene Glycol Dimethacrylate is shipped in well - sealed containers, compliant with chemical transportation regulations. It's carefully packaged to prevent leakage, transported under proper conditions to maintain stability during transit. |
귀하의 예산에 맞는 경쟁력 있는 테트라에틸렌글리콜디메타크릴레이트 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.
