|
HS 코드 |
200980 |
| Productname | Trans-3-(3-Thienyl)Acrylic Acid |
| Casnumber | 14827-36-4 |
| Molecularformula | C7H6O2S |
| Molecularweight | 154.19 |
| Appearance | Pale yellow solid |
| Meltingpoint | 142-146°C |
| Purity | Typically ≥98% |
| Solubility | Slightly soluble in water |
| Smiles | C1=CSC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/b4-3+ |
| Synonyms | trans-3-(3-Thienyl)acrylic acid; (E)-3-(3-Thienyl)acrylic acid |
| Storagetemperature | Store at 2-8°C |
공인된 트랜스-3-(3-티에닐)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of Trans - 3 - (3 - Thienyl)Acrylic Acid in a sealed, labeled chemical - grade container. |
| Storage | Trans - 3 - (3 - Thienyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, in a well - ventilated area to ensure safety. |
| Shipping | Trans - 3 - (3 - Thienyl)Acrylic Acid is shipped with strict safety protocols. Packed in air - tight, corrosion - resistant containers, it's transported by specialized carriers compliant with chemical shipping regulations to ensure secure delivery. |
귀하의 예산에 맞는 경쟁력 있는 트랜스-3-(3-티에닐)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.