|
HS 코드 |
280893 |
| Iupac Name | (Z)-3-[3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl]prop-2-enoic acid |
| Molecular Formula | C13H7F6N3O2 |
| Molecular Weight | 349.21 g/mol |
| Cas Number | 1198227-20-7 |
| Synonyms | (Z)-3-[3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl]acrylic acid |
| Appearance | White to off-white solid |
| Smiles | C1=CC(=CC(=C1N2C=NN=C2)/C=C/C(=O)O)C(F)(F)F |
| Inchikey | YAYQZVRBKSPXFV-QPLCGJKRSA-N |
| Solubility | Soluble in DMSO and methanol |
공인된 (Z)-3-(3-(3,5-비스(트리플루오로메틸)페닐)-1H-1,2,4-트리아졸-1-일)아크릴산 공장으로서, 당사는 엄격한 품질 프로토콜을 시행합니다. 모든 배치는 일관된 효능과 안전 기준을 보장하기 위해 엄격한 테스트를 거칩니다.
| Packing | 100g of (Z)-3-(3-(3,5 - Bis(trifluoromethyl)phenyl)-1H - 1,2,4 - triazol - 1 - yl)acrylic acid in sealed vial. |
| Storage | Store (Z)-3-(3-(3,5-Bis(trifluoromethyl)phenyl)-1H -1,2,4 -triazol-1-yl)acrylic acid in a cool, dry place, away from heat and direct sunlight. Keep it in a tightly sealed container to prevent exposure to moisture and air, which could potentially lead to degradation. Avoid storing near incompatible substances. |
| Shipping | The chemical (Z)-3-(3-(3,5 - Bis(trifluoromethyl)phenyl)-1H - 1,2,4 - triazol - 1 - yl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. Special handling per safety regulations for chemicals is ensured during transit. |
귀하의 예산에 맞는 경쟁력 있는 (Z)-3-(3-(3,5-비스(트리플루오로메틸)페닐)-1H-1,2,4-트리아졸-1-일)아크릴산 가격 - 모든 주문에 대해 유연한 조건과 맞춤 견적을 제공합니다.
샘플, 가격 또는 더 많은 정보를 원하시면 다음 주소로 전화 주십시오.+8615365186327 또는 메일 sales3@ascent-chem.com.
최대한 빨리 답변해 드리겠습니다.